C15H15NO — CID 143539677
9-methyl-2-azatetracyclo[8.5.0.01,14.03,8]pentadeca-2,4,6,8,10,12-hexaene;hydrate (PubChem CID 143539677) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 9-methyl-2-azatetracyclo[8.5.0.01,14.03,8]pentadeca-2,4,6,8,10,12-hexaene;hydrate.
| Compound Name | 9-methyl-2-azatetracyclo[8.5.0.01,14.03,8]pentadeca-2,4,6,8,10,12-hexaene;hydrate |
|---|---|
| PubChem CID | 143539677 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 9-methyl-2-azatetracyclo[8.5.0.01,14.03,8]pentadeca-2,4,6,8,10,12-hexaene;hydrate |
| SMILES | CC1=c2ccccc2=NC23CC2C=CC=C13.O |
| InChI | InChI=1S/C15H13N.H2O/c1-10-12-6-2-3-8-14(12)16-15-9-11(15)5-4-7-13(10)15;/h2-8,11H,9H2,1H3;1H2 |
| InChIKey | NYCQDSQAWKZZSN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |