C22H25BIN3O2S — CID 143540345
[3-[(E,1Z)-1-(2-methylidene-1H-pyrrol-3-ylidene)but-2-en-2-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite (PubChem CID 143540345) has the molecular formula C22H25BIN3O2S and a molecular weight of 533.24 g/mol. Its IUPAC name is [3-[(E,1Z)-1-(2-methylidene-1H-pyrrol-3-ylidene)but-2-en-2-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite.
| Compound Name | [3-[(E,1Z)-1-(2-methylidene-1H-pyrrol-3-ylidene)but-2-en-2-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 143540345 |
| Molecular Formula | C22H25BIN3O2S |
| Molecular Weight | 533.24 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | [3-[(E,1Z)-1-(2-methylidene-1H-pyrrol-3-ylidene)but-2-en-2-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite |
| SMILES | C=c1[nH]cc/c1=C/C(=C\C)c1cn(SI)c2ncc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C22H25BIN3O2S/c1-7-15(10-16-8-9-25-14(16)2)19-13-27(30-24)20-18(19)11-17(12-26-20)23-28-21(3,4)22(5,6)29-23/h7-13,25H,2H2,1,3-6H3/b15-7+,16-10- |
| InChIKey | QOYBQMLINARGIH-CECBYWJVSA-N |
| XLogP | 3.80 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|