C17H18BIN2O3S — CID 143540401
[3-(furan-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite (PubChem CID 143540401) has the molecular formula C17H18BIN2O3S and a molecular weight of 468.13 g/mol. Its IUPAC name is [3-(furan-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite.
| Compound Name | [3-(furan-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 143540401 |
| Molecular Formula | C17H18BIN2O3S |
| Molecular Weight | 468.13 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | [3-(furan-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite |
| SMILES | CC1(C)OB(c2cnc3c(c2)c(-c2ccoc2)cn3SI)OC1(C)C |
| InChI | InChI=1S/C17H18BIN2O3S/c1-16(2)17(3,4)24-18(23-16)12-7-13-14(11-5-6-22-10-11)9-21(25-19)15(13)20-8-12/h5-10H,1-4H3 |
| InChIKey | XIPMGGBAPLSYKD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.13 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|