C29H41N3O — CID 143540713
4-cyclopentylpiperazine-1-carbaldehyde;2-ethyl-6-(4-ethylphenyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 143540713) has the molecular formula C29H41N3O and a molecular weight of 447.67 g/mol. Its IUPAC name is 4-cyclopentylpiperazine-1-carbaldehyde;2-ethyl-6-(4-ethylphenyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 4-cyclopentylpiperazine-1-carbaldehyde;2-ethyl-6-(4-ethylphenyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 143540713 |
| Molecular Formula | C29H41N3O |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 447.32 |
| IUPAC Name | 4-cyclopentylpiperazine-1-carbaldehyde;2-ethyl-6-(4-ethylphenyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | CCc1ccc(-c2ccc3c(c2)CCN(CC)C3)cc1.O=CN1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C19H23N.C10H18N2O/c1-3-15-5-7-16(8-6-15)17-9-10-19-14-20(4-2)12-11-18(19)13-17;13-9-11-5-7-12(8-6-11)10-3-1-2-4-10/h5-10,13H,3-4,11-12,14H2,1-2H3;9-10H,1-8H2 |
| InChIKey | KYUPXSUSESYXMO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|