C31H43N3O4 — CID 143540929
1-(4-cyclopentylpiperazin-1-yl)-2-[6-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone;ethene (PubChem CID 143540929) has the molecular formula C31H43N3O4 and a molecular weight of 521.70 g/mol. Its IUPAC name is 1-(4-cyclopentylpiperazin-1-yl)-2-[6-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone;ethene.
| Compound Name | 1-(4-cyclopentylpiperazin-1-yl)-2-[6-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone;ethene |
|---|---|
| PubChem CID | 143540929 |
| Molecular Formula | C31H43N3O4 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | 1-(4-cyclopentylpiperazin-1-yl)-2-[6-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone;ethene |
| SMILES | C=C.COc1cc(-c2ccc3c(c2)CCN(CC(=O)N2CCN(C4CCCC4)CC2)C3)cc(OC)c1OC |
| InChI | InChI=1S/C29H39N3O4.C2H4/c1-34-26-17-24(18-27(35-2)29(26)36-3)21-8-9-23-19-30(11-10-22(23)16-21)20-28(33)32-14-12-31(13-15-32)25-6-4-5-7-25;1-2/h8-9,16-18,25H,4-7,10-15,19-20H2,1-3H3;1-2H2 |
| InChIKey | HJOWCMULQFWMPS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|