About 2-cyanoethyl dihydrogen phosphite
2-cyanoethyl dihydrogen phosphite (PubChem CID 14354114) has the molecular formula C3H6NO3P
and a molecular weight of 135.06 g/mol. Its IUPAC name is 2-cyanoethyl dihydrogen phosphite.
Molecular Properties
| Compound Name | 2-cyanoethyl dihydrogen phosphite |
| PubChem CID | 14354114 |
| Molecular Formula | C3H6NO3P |
| Molecular Weight | 135.06 g/mol |
| Exact Mass | 135.01 |
| IUPAC Name | 2-cyanoethyl dihydrogen phosphite |
| SMILES | N#CCCOP(O)O |
| InChI | InChI=1S/C3H6NO3P/c4-2-1-3-7-8(5)6/h5-6H,1,3H2 |
| InChIKey | ARVQIYGIIOWVCP-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.06 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl dihydrogen phosphite?
The IUPAC name of 2-cyanoethyl dihydrogen phosphite (CID 14354114) is 2-cyanoethyl dihydrogen phosphite.
What is the SMILES notation for 2-cyanoethyl dihydrogen phosphite?
The canonical SMILES for 2-cyanoethyl dihydrogen phosphite is N#CCCOP(O)O.
What is the InChIKey of 2-cyanoethyl dihydrogen phosphite?
The InChIKey is ARVQIYGIIOWVCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6NO3P/c4-2-1-3-7-8(5)6/h5-6H,1,3H2.
What are the key properties of 2-cyanoethyl dihydrogen phosphite?
2-cyanoethyl dihydrogen phosphite has a molecular weight of 135.06 g/mol, XLogP of 0.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl dihydrogen phosphite is sourced from PubChem (CID 14354114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).