C26H32FN3O2 — CID 143541537
1-[8-amino-6-[3-(2-ethylcyclohexa-1,5-dien-1-yl)propylamino]-7-fluoro-2-methyl-10-methylidene-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-11-yl]ethenol (PubChem CID 143541537) has the molecular formula C26H32FN3O2 and a molecular weight of 437.56 g/mol. Its IUPAC name is 1-[8-amino-6-[3-(2-ethylcyclohexa-1,5-dien-1-yl)propylamino]-7-fluoro-2-methyl-10-methylidene-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-11-yl]ethenol.
| Compound Name | 1-[8-amino-6-[3-(2-ethylcyclohexa-1,5-dien-1-yl)propylamino]-7-fluoro-2-methyl-10-methylidene-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-11-yl]ethenol |
|---|---|
| PubChem CID | 143541537 |
| Molecular Formula | C26H32FN3O2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 1-[8-amino-6-[3-(2-ethylcyclohexa-1,5-dien-1-yl)propylamino]-7-fluoro-2-methyl-10-methylidene-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-11-yl]ethenol |
| SMILES | C=C(O)C1=CN2c3c(c(NCCCC4=C(CC)CCC=C4)c(F)c(N)c3C1=C)OCC2C |
| InChI | InChI=1S/C26H32FN3O2/c1-5-18-9-6-7-10-19(18)11-8-12-29-24-22(27)23(28)21-16(3)20(17(4)31)13-30-15(2)14-32-26(24)25(21)30/h7,10,13,15,29,31H,3-6,8-9,11-12,14,28H2,1-2H3 |
| InChIKey | KGCJKCKAHFMJEC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|