C18H26N2O — CID 143542035
N-but-2-ynyl-2-(1H-indol-3-yl)acetamide;ethane (PubChem CID 143542035) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is N-but-2-ynyl-2-(1H-indol-3-yl)acetamide;ethane.
| Compound Name | N-but-2-ynyl-2-(1H-indol-3-yl)acetamide;ethane |
|---|---|
| PubChem CID | 143542035 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-but-2-ynyl-2-(1H-indol-3-yl)acetamide;ethane |
| SMILES | CC.CC.CC#CCNC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H14N2O.2C2H6/c1-2-3-8-15-14(17)9-11-10-16-13-7-5-4-6-12(11)13;2*1-2/h4-7,10,16H,8-9H2,1H3,(H,15,17);2*1-2H3 |
| InChIKey | PFNFROAFQJLTGW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|