C11H25NO — CID 143542065
ethane;2-methoxy-5-methyl-1,2,3,4-tetrahydropyridine (PubChem CID 143542065) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is ethane;2-methoxy-5-methyl-1,2,3,4-tetrahydropyridine.
| Compound Name | ethane;2-methoxy-5-methyl-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 143542065 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | ethane;2-methoxy-5-methyl-1,2,3,4-tetrahydropyridine |
| SMILES | CC.CC.COC1CCC(C)=CN1 |
| InChI | InChI=1S/C7H13NO.2C2H6/c1-6-3-4-7(9-2)8-5-6;2*1-2/h5,7-8H,3-4H2,1-2H3;2*1-2H3 |
| InChIKey | YEBKGIGSNNCVSC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |