About acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide
acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide (PubChem CID 143542096) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide.
Molecular Properties
| Compound Name | acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide |
| PubChem CID | 143542096 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide |
| SMILES | C#C.CCC.CCC(=O)N[C@H]1CCNC1 |
| InChI | InChI=1S/C7H14N2O.C3H8.C2H2/c1-2-7(10)9-6-3-4-8-5-6;1-3-2;1-2/h6,8H,2-5H2,1H3,(H,9,10);3H2,1-2H3;1-2H/t6-;;/m0../s1 |
| InChIKey | OXAXVAJKDVFOJZ-ILKKLZGPSA-N |
| XLogP | 1.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide?
The IUPAC name of acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide (CID 143542096) is acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide.
What is the SMILES notation for acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide?
The canonical SMILES for acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide is C#C.CCC.CCC(=O)N[C@H]1CCNC1.
What is the InChIKey of acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide?
The InChIKey is OXAXVAJKDVFOJZ-ILKKLZGPSA-N. The full InChI is InChI=1S/C7H14N2O.C3H8.C2H2/c1-2-7(10)9-6-3-4-8-5-6;1-3-2;1-2/h6,8H,2-5H2,1H3,(H,9,10);3H2,1-2H3;1-2H/t6-;;/m0../s1.
What are the key properties of acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide?
acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide has a molecular weight of 212.34 g/mol, XLogP of 1.54, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;propane;N-[(3S)-pyrrolidin-3-yl]propanamide is sourced from PubChem (CID 143542096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).