About ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine
ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine (PubChem CID 143542471) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine.
Molecular Properties
| Compound Name | ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine |
| PubChem CID | 143542471 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine |
| SMILES | C=C/C=C1/NCCO/C1=C/C.CC |
| InChI | InChI=1S/C9H13NO.C2H6/c1-3-5-8-9(4-2)11-7-6-10-8;1-2/h3-5,10H,1,6-7H2,2H3;1-2H3/b8-5+,9-4+; |
| InChIKey | MIHMYXVINUMGDX-YKAKIOLUSA-N |
| XLogP | 2.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine?
The IUPAC name of ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine (CID 143542471) is ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine.
What is the SMILES notation for ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine?
The canonical SMILES for ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine is C=C/C=C1/NCCO/C1=C/C.CC.
What is the InChIKey of ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine?
The InChIKey is MIHMYXVINUMGDX-YKAKIOLUSA-N. The full InChI is InChI=1S/C9H13NO.C2H6/c1-3-5-8-9(4-2)11-7-6-10-8;1-2/h3-5,10H,1,6-7H2,2H3;1-2H3/b8-5+,9-4+;.
What are the key properties of ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine?
ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine has a molecular weight of 181.28 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E,3E)-2-ethylidene-3-prop-2-enylidenemorpholine is sourced from PubChem (CID 143542471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).