About 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane
3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane (PubChem CID 143542920) has the molecular formula C18H18ClFN2O2S
and a molecular weight of 380.87 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane.
Molecular Properties
| Compound Name | 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane |
| PubChem CID | 143542920 |
| Molecular Formula | C18H18ClFN2O2S |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane |
| SMILES | CC.Cc1c(OCc2nc3cc(Cl)ccc3s2)ccc(F)c1C(N)=O |
| InChI | InChI=1S/C16H12ClFN2O2S.C2H6/c1-8-12(4-3-10(18)15(8)16(19)21)22-7-14-20-11-6-9(17)2-5-13(11)23-14;1-2/h2-6H,7H2,1H3,(H2,19,21);1-2H3 |
| InChIKey | UZGGGMNNELFUII-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane?
The IUPAC name of 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane (CID 143542920) is 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane.
What is the SMILES notation for 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane?
The canonical SMILES for 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane is CC.Cc1c(OCc2nc3cc(Cl)ccc3s2)ccc(F)c1C(N)=O.
What is the InChIKey of 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane?
The InChIKey is UZGGGMNNELFUII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClFN2O2S.C2H6/c1-8-12(4-3-10(18)15(8)16(19)21)22-7-14-20-11-6-9(17)2-5-13(11)23-14;1-2/h2-6H,7H2,1H3,(H2,19,21);1-2H3.
What are the key properties of 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane?
3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane has a molecular weight of 380.87 g/mol, XLogP of 5.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-6-fluoro-2-methylbenzamide;ethane is sourced from PubChem (CID 143542920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).