C13H27NO — CID 143543963
N-[2-(3,6-dihydro-2H-pyran-5-yl)ethyl]-3,3-dimethylbutan-1-amine;molecular hydrogen (PubChem CID 143543963) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is N-[2-(3,6-dihydro-2H-pyran-5-yl)ethyl]-3,3-dimethylbutan-1-amine;molecular hydrogen.
| Compound Name | N-[2-(3,6-dihydro-2H-pyran-5-yl)ethyl]-3,3-dimethylbutan-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 143543963 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | N-[2-(3,6-dihydro-2H-pyran-5-yl)ethyl]-3,3-dimethylbutan-1-amine;molecular hydrogen |
| SMILES | CC(C)(C)CCNCCC1=CCCOC1.[H][H] |
| InChI | InChI=1S/C13H25NO.H2/c1-13(2,3)7-9-14-8-6-12-5-4-10-15-11-12;/h5,14H,4,6-11H2,1-3H3;1H |
| InChIKey | XWTFJGAOJGTNAK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|