C22H19F3N3O3U- — CID 143544127
N-[2-(4-hydroxypyrrolidin-3-yl)-1-oxoisoquinolin-5-yl]-2-[3-(trifluoromethyl)benzene-4-id-1-yl]acetamide;uranium (PubChem CID 143544127) has the molecular formula C22H19F3N3O3U- and a molecular weight of 668.43 g/mol. Its IUPAC name is N-[2-(4-hydroxypyrrolidin-3-yl)-1-oxoisoquinolin-5-yl]-2-[3-(trifluoromethyl)benzene-4-id-1-yl]acetamide;uranium.
| Compound Name | N-[2-(4-hydroxypyrrolidin-3-yl)-1-oxoisoquinolin-5-yl]-2-[3-(trifluoromethyl)benzene-4-id-1-yl]acetamide;uranium |
|---|---|
| PubChem CID | 143544127 |
| Molecular Formula | C22H19F3N3O3U- |
| Molecular Weight | 668.43 g/mol |
| Exact Mass | 668.19 |
| IUPAC Name | N-[2-(4-hydroxypyrrolidin-3-yl)-1-oxoisoquinolin-5-yl]-2-[3-(trifluoromethyl)benzene-4-id-1-yl]acetamide;uranium |
| SMILES | O=C(Cc1cc[c-]c(C(F)(F)F)c1)Nc1cccc2c(=O)n(C3CNCC3O)ccc12.[U] |
| InChI | InChI=1S/C22H19F3N3O3.U/c23-22(24,25)14-4-1-3-13(9-14)10-20(30)27-17-6-2-5-16-15(17)7-8-28(21(16)31)18-11-26-12-19(18)29;/h1-3,5-9,18-19,26,29H,10-12H2,(H,27,30);/q-1; |
| InChIKey | YBOCVJOMPRGQHW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|