C19H23N3O2 — CID 143544307
3-[(2E,4E,6Z)-5-amino-2-methylocta-2,4,6-trienyl]-N-hydroxy-1-methylindole-5-carboxamide (PubChem CID 143544307) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-[(2E,4E,6Z)-5-amino-2-methylocta-2,4,6-trienyl]-N-hydroxy-1-methylindole-5-carboxamide.
| Compound Name | 3-[(2E,4E,6Z)-5-amino-2-methylocta-2,4,6-trienyl]-N-hydroxy-1-methylindole-5-carboxamide |
|---|---|
| PubChem CID | 143544307 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 3-[(2E,4E,6Z)-5-amino-2-methylocta-2,4,6-trienyl]-N-hydroxy-1-methylindole-5-carboxamide |
| SMILES | C/C=C\C(N)=C/C=C(\C)Cc1cn(C)c2ccc(C(=O)NO)cc12 |
| InChI | InChI=1S/C19H23N3O2/c1-4-5-16(20)8-6-13(2)10-15-12-22(3)18-9-7-14(11-17(15)18)19(23)21-24/h4-9,11-12,24H,10,20H2,1-3H3,(H,21,23)/b5-4-,13-6+,16-8+ |
| InChIKey | JGQUPTNVYPNNPI-KDNSRYCVSA-N |
| XLogP | 3.20 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|