C20H30N3S+ — CID 143546375
methyl-[(1Z,3Z)-3-[(E)-2-[4-[4-(2-sulfanylethyl)piperazin-1-yl]phenyl]ethenyl]penta-1,3-dienyl]azanium (PubChem CID 143546375) has the molecular formula C20H30N3S+ and a molecular weight of 344.55 g/mol. Its IUPAC name is methyl-[(1Z,3Z)-3-[(E)-2-[4-[4-(2-sulfanylethyl)piperazin-1-yl]phenyl]ethenyl]penta-1,3-dienyl]azanium.
| Compound Name | methyl-[(1Z,3Z)-3-[(E)-2-[4-[4-(2-sulfanylethyl)piperazin-1-yl]phenyl]ethenyl]penta-1,3-dienyl]azanium |
|---|---|
| PubChem CID | 143546375 |
| Molecular Formula | C20H30N3S+ |
| Molecular Weight | 344.55 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | methyl-[(1Z,3Z)-3-[(E)-2-[4-[4-(2-sulfanylethyl)piperazin-1-yl]phenyl]ethenyl]penta-1,3-dienyl]azanium |
| SMILES | C/C=C(\C=C/[NH2+]C)/C=C/c1ccc(N2CCN(CCS)CC2)cc1 |
| InChI | InChI=1S/C20H29N3S/c1-3-18(10-11-21-2)4-5-19-6-8-20(9-7-19)23-14-12-22(13-15-23)16-17-24/h3-11,21,24H,12-17H2,1-2H3/p+1/b5-4+,11-10-,18-3- |
| InChIKey | TYRBFJOKERDBNC-VXYOUHLYSA-O |
| XLogP | 2.40 |
| TPSA | 23.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|