C27H35N3O2S — CID 143546452
S-[2-[methyl-[3-[methyl-[4-[(1E,3Z)-3-[(Z)-2-(methylamino)ethenyl]penta-1,3-dienyl]naphthalen-1-yl]amino]propyl]amino]-2-oxoethyl] ethanethioate (PubChem CID 143546452) has the molecular formula C27H35N3O2S and a molecular weight of 465.66 g/mol. Its IUPAC name is S-[2-[methyl-[3-[methyl-[4-[(1E,3Z)-3-[(Z)-2-(methylamino)ethenyl]penta-1,3-dienyl]naphthalen-1-yl]amino]propyl]amino]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[methyl-[3-[methyl-[4-[(1E,3Z)-3-[(Z)-2-(methylamino)ethenyl]penta-1,3-dienyl]naphthalen-1-yl]amino]propyl]amino]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 143546452 |
| Molecular Formula | C27H35N3O2S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | S-[2-[methyl-[3-[methyl-[4-[(1E,3Z)-3-[(Z)-2-(methylamino)ethenyl]penta-1,3-dienyl]naphthalen-1-yl]amino]propyl]amino]-2-oxoethyl] ethanethioate |
| SMILES | C/C=C(\C=C/NC)/C=C/c1ccc(N(C)CCCN(C)C(=O)CSC(C)=O)c2ccccc12 |
| InChI | InChI=1S/C27H35N3O2S/c1-6-22(16-17-28-3)12-13-23-14-15-26(25-11-8-7-10-24(23)25)29(4)18-9-19-30(5)27(32)20-33-21(2)31/h6-8,10-17,28H,9,18-20H2,1-5H3/b13-12+,17-16-,22-6- |
| InChIKey | IOHRDKWLCVFEIX-APZCYYRQSA-N |
| XLogP | 5.10 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|