C27H34N4S+2 — CID 143546610
[(1Z,3Z)-3-[(E)-2-[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]naphthalen-1-yl]ethenyl]hexa-1,3,5-trienyl]-methylazanium (PubChem CID 143546610) has the molecular formula C27H34N4S+2 and a molecular weight of 446.66 g/mol. Its IUPAC name is [(1Z,3Z)-3-[(E)-2-[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]naphthalen-1-yl]ethenyl]hexa-1,3,5-trienyl]-methylazanium.
| Compound Name | [(1Z,3Z)-3-[(E)-2-[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]naphthalen-1-yl]ethenyl]hexa-1,3,5-trienyl]-methylazanium |
|---|---|
| PubChem CID | 143546610 |
| Molecular Formula | C27H34N4S+2 |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | [(1Z,3Z)-3-[(E)-2-[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]naphthalen-1-yl]ethenyl]hexa-1,3,5-trienyl]-methylazanium |
| SMILES | C=C/C=C(\C=C/[NH2+]C)/C=C/c1ccc(N(C)CCSc2n(C)cc[n+]2C)c2ccccc12 |
| InChI | InChI=1S/C27H33N4S/c1-6-9-22(16-17-28-2)12-13-23-14-15-26(25-11-8-7-10-24(23)25)29(3)20-21-32-27-30(4)18-19-31(27)5/h6-19,28H,1,20-21H2,2-5H3/q+1/p+1/b13-12+,17-16-,22-9- |
| InChIKey | RZWYIKHRDLHOAP-YTVUPGKNSA-O |
| XLogP | 4.06 |
| TPSA | 28.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|