C33H53NO10 — CID 143547370
[(3E,5E)-6-[(4E)-6-acetyloxy-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2-methylhepta-3,5-dienyl] 2-aminoacetate (PubChem CID 143547370) has the molecular formula C33H53NO10 and a molecular weight of 623.78 g/mol. Its IUPAC name is [(3E,5E)-6-[(4E)-6-acetyloxy-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2-methylhepta-3,5-dienyl] 2-aminoacetate.
| Compound Name | [(3E,5E)-6-[(4E)-6-acetyloxy-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2-methylhepta-3,5-dienyl] 2-aminoacetate |
|---|---|
| PubChem CID | 143547370 |
| Molecular Formula | C33H53NO10 |
| Molecular Weight | 623.78 g/mol |
| Exact Mass | 623.37 |
| IUPAC Name | [(3E,5E)-6-[(4E)-6-acetyloxy-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2-methylhepta-3,5-dienyl] 2-aminoacetate |
| SMILES | CCC(OC)C(C)C1OC1C(OC(=O)CN)C(C)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)(O)C(OC(C)=O)/C=C/C1C |
| InChI | InChI=1S/C33H53NO10/c1-9-25(40-8)22(5)31-32(44-31)30(43-28(38)18-34)20(3)12-10-11-19(2)29-21(4)13-14-26(41-23(6)35)33(7,39)16-15-24(36)17-27(37)42-29/h10-14,20-22,24-26,29-32,36,39H,9,15-18,34H2,1-8H3/b12-10+,14-13+,19-11+ |
| InChIKey | ZAEHXRNWTASYAO-VKOKYELPSA-N |
| XLogP | 3.16 |
| TPSA | 167.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.78 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|