About 2-methylquinolin-8-ol;2-phenylphenol;propane
2-methylquinolin-8-ol;2-phenylphenol;propane (PubChem CID 143547724) has the molecular formula C25H27NO2
and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-methylquinolin-8-ol;2-phenylphenol;propane.
Molecular Properties
| Compound Name | 2-methylquinolin-8-ol;2-phenylphenol;propane |
| PubChem CID | 143547724 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-methylquinolin-8-ol;2-phenylphenol;propane |
| SMILES | CCC.Cc1ccc2cccc(O)c2n1.Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10O.C10H9NO.C3H8/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-7-5-6-8-3-2-4-9(12)10(8)11-7;1-3-2/h1-9,13H;2-6,12H,1H3;3H2,1-2H3 |
| InChIKey | JHKJVHFUTUDXHG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylquinolin-8-ol;2-phenylphenol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylquinolin-8-ol;2-phenylphenol;propane?
The IUPAC name of 2-methylquinolin-8-ol;2-phenylphenol;propane (CID 143547724) is 2-methylquinolin-8-ol;2-phenylphenol;propane.
What is the SMILES notation for 2-methylquinolin-8-ol;2-phenylphenol;propane?
The canonical SMILES for 2-methylquinolin-8-ol;2-phenylphenol;propane is CCC.Cc1ccc2cccc(O)c2n1.Oc1ccccc1-c1ccccc1.
What is the InChIKey of 2-methylquinolin-8-ol;2-phenylphenol;propane?
The InChIKey is JHKJVHFUTUDXHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C10H9NO.C3H8/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-7-5-6-8-3-2-4-9(12)10(8)11-7;1-3-2/h1-9,13H;2-6,12H,1H3;3H2,1-2H3.
What are the key properties of 2-methylquinolin-8-ol;2-phenylphenol;propane?
2-methylquinolin-8-ol;2-phenylphenol;propane has a molecular weight of 373.50 g/mol, XLogP of 6.72, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylquinolin-8-ol;2-phenylphenol;propane is sourced from PubChem (CID 143547724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).