C30H34F3N7O7 — CID 143547875
2-[4-[(4-carbamimidoylanilino)-[1-[(2E,4E)-4-methoxyhepta-2,4,6-trien-3-yl]-5-oxo-4H-1,2,4-triazol-3-yl]methyl]-2-methoxyphenoxy]-N-methylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 143547875) has the molecular formula C30H34F3N7O7 and a molecular weight of 661.64 g/mol. Its IUPAC name is 2-[4-[(4-carbamimidoylanilino)-[1-[(2E,4E)-4-methoxyhepta-2,4,6-trien-3-yl]-5-oxo-4H-1,2,4-triazol-3-yl]methyl]-2-methoxyphenoxy]-N-methylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[(4-carbamimidoylanilino)-[1-[(2E,4E)-4-methoxyhepta-2,4,6-trien-3-yl]-5-oxo-4H-1,2,4-triazol-3-yl]methyl]-2-methoxyphenoxy]-N-methylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 143547875 |
| Molecular Formula | C30H34F3N7O7 |
| Molecular Weight | 661.64 g/mol |
| Exact Mass | 661.25 |
| IUPAC Name | 2-[4-[(4-carbamimidoylanilino)-[1-[(2E,4E)-4-methoxyhepta-2,4,6-trien-3-yl]-5-oxo-4H-1,2,4-triazol-3-yl]methyl]-2-methoxyphenoxy]-N-methylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(c2ccc(OCC(=O)NC)c(OC)c2)c2nn(C(=C/C)/C(=C\C=C)OC)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C28H33N7O5.C2HF3O2/c1-6-8-21(38-4)20(7-2)35-28(37)33-27(34-35)25(32-19-12-9-17(10-13-19)26(29)30)18-11-14-22(23(15-18)39-5)40-16-24(36)31-3;3-2(4,5)1(6)7/h6-15,25,32H,1,16H2,2-5H3,(H3,29,30)(H,31,36)(H,33,34,37);(H,6,7)/b20-7+,21-8+; |
| InChIKey | AKSNNQRCVKDSPD-QVTJNOTLSA-N |
| XLogP | 3.40 |
| TPSA | 206.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|