C18H21NO3 — CID 143548476
[(2Z,4E,6E)-7-methyl-8-oxonona-2,4,6-trien-4-yl] N-cyclohepta-1,4,6-trien-1-ylcarbamate (PubChem CID 143548476) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is [(2Z,4E,6E)-7-methyl-8-oxonona-2,4,6-trien-4-yl] N-cyclohepta-1,4,6-trien-1-ylcarbamate.
| Compound Name | [(2Z,4E,6E)-7-methyl-8-oxonona-2,4,6-trien-4-yl] N-cyclohepta-1,4,6-trien-1-ylcarbamate |
|---|---|
| PubChem CID | 143548476 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [(2Z,4E,6E)-7-methyl-8-oxonona-2,4,6-trien-4-yl] N-cyclohepta-1,4,6-trien-1-ylcarbamate |
| SMILES | C/C=C\C(=C/C=C(\C)C(C)=O)OC(=O)NC1=CCC=CC=C1 |
| InChI | InChI=1S/C18H21NO3/c1-4-9-17(13-12-14(2)15(3)20)22-18(21)19-16-10-7-5-6-8-11-16/h4-7,9-13H,8H2,1-3H3,(H,19,21)/b9-4-,14-12+,17-13+ |
| InChIKey | LNGCCEYTYGDGKS-DREYDMFZSA-N |
| XLogP | 4.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|