C22H26F2N8O — CID 143549138
N,N',2-triamino-5-[4-[(2-amino-2-hydroxypropyl)-methylamino]phenyl]-N-(2,3-difluorophenyl)pyridine-3-carboximidamide (PubChem CID 143549138) has the molecular formula C22H26F2N8O and a molecular weight of 456.50 g/mol. Its IUPAC name is N,N',2-triamino-5-[4-[(2-amino-2-hydroxypropyl)-methylamino]phenyl]-N-(2,3-difluorophenyl)pyridine-3-carboximidamide.
| Compound Name | N,N',2-triamino-5-[4-[(2-amino-2-hydroxypropyl)-methylamino]phenyl]-N-(2,3-difluorophenyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 143549138 |
| Molecular Formula | C22H26F2N8O |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N,N',2-triamino-5-[4-[(2-amino-2-hydroxypropyl)-methylamino]phenyl]-N-(2,3-difluorophenyl)pyridine-3-carboximidamide |
| SMILES | CN(CC(C)(N)O)c1ccc(-c2cnc(N)c(/C(=N/N)N(N)c3cccc(F)c3F)c2)cc1 |
| InChI | InChI=1S/C22H26F2N8O/c1-22(26,33)12-31(2)15-8-6-13(7-9-15)14-10-16(20(25)29-11-14)21(30-27)32(28)18-5-3-4-17(23)19(18)24/h3-11,33H,12,26-28H2,1-2H3,(H2,25,29)/b30-21- |
| InChIKey | MQXKPRXBQQTOMK-OFWBYEQRSA-N |
| XLogP | 1.71 |
| TPSA | 156.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|