C17H13ClF2N6 — CID 143549199
N,2-diamino-N'-(3-chloro-2,6-difluorophenyl)-5-pyridin-3-ylpyridine-3-carboximidamide (PubChem CID 143549199) has the molecular formula C17H13ClF2N6 and a molecular weight of 374.78 g/mol. Its IUPAC name is N,2-diamino-N'-(3-chloro-2,6-difluorophenyl)-5-pyridin-3-ylpyridine-3-carboximidamide.
| Compound Name | N,2-diamino-N'-(3-chloro-2,6-difluorophenyl)-5-pyridin-3-ylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 143549199 |
| Molecular Formula | C17H13ClF2N6 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N,2-diamino-N'-(3-chloro-2,6-difluorophenyl)-5-pyridin-3-ylpyridine-3-carboximidamide |
| SMILES | NN/C(=N\c1c(F)ccc(Cl)c1F)c1cc(-c2cccnc2)cnc1N |
| InChI | InChI=1S/C17H13ClF2N6/c18-12-3-4-13(19)15(14(12)20)25-17(26-22)11-6-10(8-24-16(11)21)9-2-1-5-23-7-9/h1-8H,22H2,(H2,21,24)(H,25,26) |
| InChIKey | PQGWTXFNYDZLNB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|