C24H41NO4 — CID 143549537
4-[(3R,7S,10R,13R)-3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide (PubChem CID 143549537) has the molecular formula C24H41NO4 and a molecular weight of 407.60 g/mol. Its IUPAC name is 4-[(3R,7S,10R,13R)-3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide.
| Compound Name | 4-[(3R,7S,10R,13R)-3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide |
|---|---|
| PubChem CID | 143549537 |
| Molecular Formula | C24H41NO4 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | 4-[(3R,7S,10R,13R)-3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide |
| SMILES | CC(CCC(N)=O)C1CCC2C3C(O)C(O)C4C[C@H](O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C24H41NO4/c1-13(4-7-19(25)27)15-5-6-16-20-17(9-11-23(15,16)2)24(3)10-8-14(26)12-18(24)21(28)22(20)29/h13-18,20-22,26,28-29H,4-12H2,1-3H3,(H2,25,27)/t13?,14-,15?,16?,17?,18?,20?,21?,22?,23-,24-/m1/s1 |
| InChIKey | HDJGRPRDEJBJHQ-SXMMBEDFSA-N |
| XLogP | 2.85 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |