C31H55N — CID 143549773
2-[(3,13-diethyl-4,10-dimethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-4-yl)methyl]-3-methylbut-2-en-1-imine;ethane (PubChem CID 143549773) has the molecular formula C31H55N and a molecular weight of 441.79 g/mol. Its IUPAC name is 2-[(3,13-diethyl-4,10-dimethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-4-yl)methyl]-3-methylbut-2-en-1-imine;ethane.
| Compound Name | 2-[(3,13-diethyl-4,10-dimethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-4-yl)methyl]-3-methylbut-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 143549773 |
| Molecular Formula | C31H55N |
| Molecular Weight | 441.79 g/mol |
| Exact Mass | 441.43 |
| IUPAC Name | 2-[(3,13-diethyl-4,10-dimethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-4-yl)methyl]-3-methylbut-2-en-1-imine;ethane |
| SMILES | CC.[H]/N=C/C(CC1(C)C(CC)CCC2(C)C3CCC4(CC)CCCC4C3CCC12)=C(C)C |
| InChI | InChI=1S/C29H49N.C2H6/c1-7-22-13-16-27(5)24-14-17-29(8-2)15-9-10-25(29)23(24)11-12-26(27)28(22,6)18-21(19-30)20(3)4;1-2/h19,22-26,30H,7-18H2,1-6H3;1-2H3/b30-19+; |
| InChIKey | OFSDLOQTDJEBDT-QUIZVCAPSA-N |
| XLogP | 9.85 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.79 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|