C15H26O5 — CID 143550076
(4R,8R)-12-hydroperoxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-ol (PubChem CID 143550076) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is (4R,8R)-12-hydroperoxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-ol.
| Compound Name | (4R,8R)-12-hydroperoxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-ol |
|---|---|
| PubChem CID | 143550076 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (4R,8R)-12-hydroperoxy-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-ol |
| SMILES | C[C@H]1C(O)OC2OC(C)(OO)CCC3C2C1CC[C@H]3C |
| InChI | InChI=1S/C15H26O5/c1-8-4-5-11-9(2)13(16)18-14-12(11)10(8)6-7-15(3,19-14)20-17/h8-14,16-17H,4-7H2,1-3H3/t8-,9-,10?,11?,12?,13?,14?,15?/m1/s1 |
| InChIKey | MFVARPRAGRPRLP-HVAMBOJXSA-N |
| XLogP | 2.59 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|