C15H16FNO4S — CID 143550376
N-(3-fluoro-4-propan-2-ylphenyl)-2,3-dihydroxybenzenesulfonamide (PubChem CID 143550376) has the molecular formula C15H16FNO4S and a molecular weight of 325.36 g/mol. Its IUPAC name is N-(3-fluoro-4-propan-2-ylphenyl)-2,3-dihydroxybenzenesulfonamide.
| Compound Name | N-(3-fluoro-4-propan-2-ylphenyl)-2,3-dihydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 143550376 |
| Molecular Formula | C15H16FNO4S |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-(3-fluoro-4-propan-2-ylphenyl)-2,3-dihydroxybenzenesulfonamide |
| SMILES | CC(C)c1ccc(NS(=O)(=O)c2cccc(O)c2O)cc1F |
| InChI | InChI=1S/C15H16FNO4S/c1-9(2)11-7-6-10(8-12(11)16)17-22(20,21)14-5-3-4-13(18)15(14)19/h3-9,17-19H,1-2H3 |
| InChIKey | DUWXGMIMCIMVDK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|