About 5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine
5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine (PubChem CID 143550522) has the molecular formula C19H27N4O+
and a molecular weight of 327.45 g/mol. Its IUPAC name is 5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine.
Molecular Properties
| Compound Name | 5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine |
| PubChem CID | 143550522 |
| Molecular Formula | C19H27N4O+ |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine |
| SMILES | COc1[nH+]cc(N2C[C@@H](C)N(Cc3ccccc3)[C@@H](C)C2)cc1N |
| InChI | InChI=1S/C19H26N4O/c1-14-11-22(17-9-18(20)19(24-3)21-10-17)12-15(2)23(14)13-16-7-5-4-6-8-16/h4-10,14-15H,11-13,20H2,1-3H3/p+1/t14-,15+ |
| InChIKey | NDWUSCJLTHYNMU-GASCZTMLSA-O |
| XLogP | 2.19 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine?
The IUPAC name of 5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine (CID 143550522) is 5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine.
What is the SMILES notation for 5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine?
The canonical SMILES for 5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine is COc1[nH+]cc(N2C[C@@H](C)N(Cc3ccccc3)[C@@H](C)C2)cc1N.
What is the InChIKey of 5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine?
The InChIKey is NDWUSCJLTHYNMU-GASCZTMLSA-O. The full InChI is InChI=1S/C19H26N4O/c1-14-11-22(17-9-18(20)19(24-3)21-10-17)12-15(2)23(14)13-16-7-5-4-6-8-16/h4-10,14-15H,11-13,20H2,1-3H3/p+1/t14-,15+.
What are the key properties of 5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine?
5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine has a molecular weight of 327.45 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3S,5R)-4-benzyl-3,5-dimethylpiperazin-1-yl]-2-methoxypyridin-1-ium-3-amine is sourced from PubChem (CID 143550522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).