About 8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole
8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole (PubChem CID 14355089) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is 8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole |
| PubChem CID | 14355089 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole |
| SMILES | COc1cccc2c3c([nH]c12)C=NCC3 |
| InChI | InChI=1S/C12H12N2O/c1-15-11-4-2-3-9-8-5-6-13-7-10(8)14-12(9)11/h2-4,7,14H,5-6H2,1H3 |
| InChIKey | LIUNAKJFUYIJFE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole?
The IUPAC name of 8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole (CID 14355089) is 8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole.
What is the SMILES notation for 8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole?
The canonical SMILES for 8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole is COc1cccc2c3c([nH]c12)C=NCC3.
What is the InChIKey of 8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole?
The InChIKey is LIUNAKJFUYIJFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O/c1-15-11-4-2-3-9-8-5-6-13-7-10(8)14-12(9)11/h2-4,7,14H,5-6H2,1H3.
What are the key properties of 8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole?
8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole has a molecular weight of 200.24 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indole is sourced from PubChem (CID 14355089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).