C27H30BrN7OS — CID 143550954
[3-bromo-4-[7-(methylamino)-3-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-1-yl]phenyl]-(1,4-diazepan-1-yl)methanone (PubChem CID 143550954) has the molecular formula C27H30BrN7OS and a molecular weight of 580.56 g/mol. Its IUPAC name is [3-bromo-4-[7-(methylamino)-3-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-1-yl]phenyl]-(1,4-diazepan-1-yl)methanone.
| Compound Name | [3-bromo-4-[7-(methylamino)-3-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-1-yl]phenyl]-(1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 143550954 |
| Molecular Formula | C27H30BrN7OS |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | [3-bromo-4-[7-(methylamino)-3-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-1-yl]phenyl]-(1,4-diazepan-1-yl)methanone |
| SMILES | C=N/C=C(\C=C/C)c1nn(-c2ccc(C(=O)N3CCCNCC3)cc2Br)c2c1CCc1nc(NC)sc1-2 |
| InChI | InChI=1S/C27H30BrN7OS/c1-4-6-18(16-29-2)23-19-8-9-21-25(37-27(30-3)32-21)24(19)35(33-23)22-10-7-17(15-20(22)28)26(36)34-13-5-11-31-12-14-34/h4,6-7,10,15-16,31H,2,5,8-9,11-14H2,1,3H3,(H,30,32)/b6-4-,18-16+ |
| InChIKey | FPIAUDQWOAGOJB-RQFQTRNDSA-N |
| XLogP | 4.95 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|