C23H21BrN6O3S — CID 143550961
3-bromo-4-[7-formamido-3-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-1-yl]-N-methoxybenzamide (PubChem CID 143550961) has the molecular formula C23H21BrN6O3S and a molecular weight of 541.43 g/mol. Its IUPAC name is 3-bromo-4-[7-formamido-3-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-1-yl]-N-methoxybenzamide.
| Compound Name | 3-bromo-4-[7-formamido-3-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-1-yl]-N-methoxybenzamide |
|---|---|
| PubChem CID | 143550961 |
| Molecular Formula | C23H21BrN6O3S |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | 3-bromo-4-[7-formamido-3-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-1-yl]-N-methoxybenzamide |
| SMILES | C=N/C=C(\C=C/C)c1nn(-c2ccc(C(=O)NOC)cc2Br)c2c1CCc1nc(NC=O)sc1-2 |
| InChI | InChI=1S/C23H21BrN6O3S/c1-4-5-14(11-25-2)19-15-7-8-17-21(34-23(27-17)26-12-31)20(15)30(28-19)18-9-6-13(10-16(18)24)22(32)29-33-3/h4-6,9-12H,2,7-8H2,1,3H3,(H,29,32)(H,26,27,31)/b5-4-,14-11+ |
| InChIKey | ARXNFGGYWQNMMS-UZWKOAOVSA-N |
| XLogP | 4.33 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|