About methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium
methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium (PubChem CID 143551737) has the molecular formula C8H10N3S+
and a molecular weight of 180.26 g/mol. Its IUPAC name is methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium.
Molecular Properties
| Compound Name | methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium |
| PubChem CID | 143551737 |
| Molecular Formula | C8H10N3S+ |
| Molecular Weight | 180.26 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium |
| SMILES | C[NH2+]c1nc(C)nc2ccsc12 |
| InChI | InChI=1S/C8H9N3S/c1-5-10-6-3-4-12-7(6)8(9-2)11-5/h3-4H,1-2H3,(H,9,10,11)/p+1 |
| InChIKey | BBDBOBLFKABDKJ-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 42.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium?
The IUPAC name of methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium (CID 143551737) is methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium.
What is the SMILES notation for methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium?
The canonical SMILES for methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium is C[NH2+]c1nc(C)nc2ccsc12.
What is the InChIKey of methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium?
The InChIKey is BBDBOBLFKABDKJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H9N3S/c1-5-10-6-3-4-12-7(6)8(9-2)11-5/h3-4H,1-2H3,(H,9,10,11)/p+1.
What are the key properties of methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium?
methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium has a molecular weight of 180.26 g/mol, XLogP of 0.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(2-methylthieno[3,2-d]pyrimidin-4-yl)azanium is sourced from PubChem (CID 143551737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).