About acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide
acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide (PubChem CID 143551777) has the molecular formula C13H23N3
and a molecular weight of 221.35 g/mol. Its IUPAC name is acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide.
Molecular Properties
| Compound Name | acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide |
| PubChem CID | 143551777 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide |
| SMILES | C#C.CC/N=C(\C=C(C)C)NC1CCNC1 |
| InChI | InChI=1S/C11H21N3.C2H2/c1-4-13-11(7-9(2)3)14-10-5-6-12-8-10;1-2/h7,10,12H,4-6,8H2,1-3H3,(H,13,14);1-2H |
| InChIKey | ZJXNTKMXOFAFAS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide?
The IUPAC name of acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide (CID 143551777) is acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide.
What is the SMILES notation for acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide?
The canonical SMILES for acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide is C#C.CC/N=C(\C=C(C)C)NC1CCNC1.
What is the InChIKey of acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide?
The InChIKey is ZJXNTKMXOFAFAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3.C2H2/c1-4-13-11(7-9(2)3)14-10-5-6-12-8-10;1-2/h7,10,12H,4-6,8H2,1-3H3,(H,13,14);1-2H.
What are the key properties of acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide?
acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide has a molecular weight of 221.35 g/mol, XLogP of 1.57, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;N'-ethyl-3-methyl-N-pyrrolidin-3-ylbut-2-enimidamide is sourced from PubChem (CID 143551777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).