C12H18N4O3 — CID 143552213
4-amino-5-[(E)-3-aminoprop-1-enyl]-1-(4-hydroxy-5-methyloxolan-2-yl)pyrimidin-2-one (PubChem CID 143552213) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-amino-5-[(E)-3-aminoprop-1-enyl]-1-(4-hydroxy-5-methyloxolan-2-yl)pyrimidin-2-one.
| Compound Name | 4-amino-5-[(E)-3-aminoprop-1-enyl]-1-(4-hydroxy-5-methyloxolan-2-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 143552213 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 4-amino-5-[(E)-3-aminoprop-1-enyl]-1-(4-hydroxy-5-methyloxolan-2-yl)pyrimidin-2-one |
| SMILES | CC1OC(n2cc(/C=C/CN)c(N)nc2=O)CC1O |
| InChI | InChI=1S/C12H18N4O3/c1-7-9(17)5-10(19-7)16-6-8(3-2-4-13)11(14)15-12(16)18/h2-3,6-7,9-10,17H,4-5,13H2,1H3,(H2,14,15,18)/b3-2+ |
| InChIKey | GTIYWMPPOGSIAV-NSCUHMNNSA-N |
| XLogP | -0.53 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |