About 3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid
3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid (PubChem CID 143552435) has the molecular formula C25H36O4
and a molecular weight of 400.56 g/mol. Its IUPAC name is 3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid.
Molecular Properties
| Compound Name | 3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid |
| PubChem CID | 143552435 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid |
| SMILES | C/C=C\CCCC(=O)O.O=C1CCC(c2ccc(C(O)C3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C18H24O2.C7H12O2/c19-17-11-10-16(12-17)13-6-8-15(9-7-13)18(20)14-4-2-1-3-5-14;1-2-3-4-5-6-7(8)9/h6-9,14,16,18,20H,1-5,10-12H2;2-3H,4-6H2,1H3,(H,8,9)/b;3-2- |
| InChIKey | ZVLAJVZMIYITJX-AHNKWOMYSA-N |
| XLogP | 5.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid?
The IUPAC name of 3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid (CID 143552435) is 3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid.
What is the SMILES notation for 3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid?
The canonical SMILES for 3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid is C/C=C\CCCC(=O)O.O=C1CCC(c2ccc(C(O)C3CCCCC3)cc2)C1.
What is the InChIKey of 3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid?
The InChIKey is ZVLAJVZMIYITJX-AHNKWOMYSA-N. The full InChI is InChI=1S/C18H24O2.C7H12O2/c19-17-11-10-16(12-17)13-6-8-15(9-7-13)18(20)14-4-2-1-3-5-14;1-2-3-4-5-6-7(8)9/h6-9,14,16,18,20H,1-5,10-12H2;2-3H,4-6H2,1H3,(H,8,9)/b;3-2-.
What are the key properties of 3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid?
3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid has a molecular weight of 400.56 g/mol, XLogP of 5.95, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[cyclohexyl(hydroxy)methyl]phenyl]cyclopentan-1-one;(Z)-hept-5-enoic acid is sourced from PubChem (CID 143552435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).