C9H14N2 — CID 143552596
2-N,4-dimethylcyclohepta-2,4,7-triene-1,2-diamine (PubChem CID 143552596) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-N,4-dimethylcyclohepta-2,4,7-triene-1,2-diamine.
| Compound Name | 2-N,4-dimethylcyclohepta-2,4,7-triene-1,2-diamine |
|---|---|
| PubChem CID | 143552596 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-N,4-dimethylcyclohepta-2,4,7-triene-1,2-diamine |
| SMILES | CNC1=CC(C)=CCC=C1N |
| InChI | InChI=1S/C9H14N2/c1-7-4-3-5-8(10)9(6-7)11-2/h4-6,11H,3,10H2,1-2H3 |
| InChIKey | AXHQDJGOPVKAPO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |