C18H28FNO2 — CID 143552626
tert-butyl 3-[(3Z,5E)-3-ethenyl-6-fluorohepta-3,5-dienyl]pyrrolidine-1-carboxylate (PubChem CID 143552626) has the molecular formula C18H28FNO2 and a molecular weight of 309.43 g/mol. Its IUPAC name is tert-butyl 3-[(3Z,5E)-3-ethenyl-6-fluorohepta-3,5-dienyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3Z,5E)-3-ethenyl-6-fluorohepta-3,5-dienyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143552626 |
| Molecular Formula | C18H28FNO2 |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | tert-butyl 3-[(3Z,5E)-3-ethenyl-6-fluorohepta-3,5-dienyl]pyrrolidine-1-carboxylate |
| SMILES | C=C/C(=C\C=C(/C)F)CCC1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H28FNO2/c1-6-15(8-7-14(2)19)9-10-16-11-12-20(13-16)17(21)22-18(3,4)5/h6-8,16H,1,9-13H2,2-5H3/b14-7+,15-8+ |
| InChIKey | XJYNSXKOYWYTDF-IROCBMIISA-N |
| XLogP | 5.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|