C18H16Cl2NO- — CID 143552740
N-[4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]ethanimidate (PubChem CID 143552740) has the molecular formula C18H16Cl2NO- and a molecular weight of 333.24 g/mol. Its IUPAC name is N-[4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]ethanimidate.
| Compound Name | N-[4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]ethanimidate |
|---|---|
| PubChem CID | 143552740 |
| Molecular Formula | C18H16Cl2NO- |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-[4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]ethanimidate |
| SMILES | C/C([O-])=N\C1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C18H17Cl2NO/c1-11(22)21-18-9-7-13(14-4-2-3-5-15(14)18)12-6-8-16(19)17(20)10-12/h2-6,8,10,13,18H,7,9H2,1H3,(H,21,22)/p-1 |
| InChIKey | YIQKGDBXOASLSF-UHFFFAOYSA-M |
| XLogP | 4.74 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|