About ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine
ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine (PubChem CID 143552932) has the molecular formula C17H23NS
and a molecular weight of 273.44 g/mol. Its IUPAC name is ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine.
Molecular Properties
| Compound Name | ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine |
| PubChem CID | 143552932 |
| Molecular Formula | C17H23NS |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine |
| SMILES | CCc1ccccc1.[H]/N=C/c1ccc(CC(C)C)s1 |
| InChI | InChI=1S/C9H13NS.C8H10/c1-7(2)5-8-3-4-9(6-10)11-8;1-2-8-6-4-3-5-7-8/h3-4,6-7,10H,5H2,1-2H3;3-7H,2H2,1H3/b10-6+; |
| InChIKey | AWLUUTAQGZUDAP-AAGWESIMSA-N |
| XLogP | 5.19 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine?
The IUPAC name of ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine (CID 143552932) is ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine.
What is the SMILES notation for ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine?
The canonical SMILES for ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine is CCc1ccccc1.[H]/N=C/c1ccc(CC(C)C)s1.
What is the InChIKey of ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine?
The InChIKey is AWLUUTAQGZUDAP-AAGWESIMSA-N. The full InChI is InChI=1S/C9H13NS.C8H10/c1-7(2)5-8-3-4-9(6-10)11-8;1-2-8-6-4-3-5-7-8/h3-4,6-7,10H,5H2,1-2H3;3-7H,2H2,1H3/b10-6+;.
What are the key properties of ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine?
ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine has a molecular weight of 273.44 g/mol, XLogP of 5.19, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethylbenzene;[5-(2-methylpropyl)thiophen-2-yl]methanimine is sourced from PubChem (CID 143552932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).