C27H25N3O — CID 143553025
[3-[2-(1-benzofuran-2-yl)-9-methyl-4,5,8,9-tetrahydrobenzo[e]indol-3-yl]phenyl]hydrazine (PubChem CID 143553025) has the molecular formula C27H25N3O and a molecular weight of 407.52 g/mol. Its IUPAC name is [3-[2-(1-benzofuran-2-yl)-9-methyl-4,5,8,9-tetrahydrobenzo[e]indol-3-yl]phenyl]hydrazine.
| Compound Name | [3-[2-(1-benzofuran-2-yl)-9-methyl-4,5,8,9-tetrahydrobenzo[e]indol-3-yl]phenyl]hydrazine |
|---|---|
| PubChem CID | 143553025 |
| Molecular Formula | C27H25N3O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | [3-[2-(1-benzofuran-2-yl)-9-methyl-4,5,8,9-tetrahydrobenzo[e]indol-3-yl]phenyl]hydrazine |
| SMILES | CC1CC=CC2=C1c1cc(-c3cc4ccccc4o3)n(-c3cccc(NN)c3)c1CC2 |
| InChI | InChI=1S/C27H25N3O/c1-17-6-4-8-18-12-13-23-22(27(17)18)16-24(26-14-19-7-2-3-11-25(19)31-26)30(23)21-10-5-9-20(15-21)29-28/h2-5,7-11,14-17,29H,6,12-13,28H2,1H3 |
| InChIKey | IEJLPSREMIFUOW-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 56.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|