C25H33ClN2O — CID 143553065
4-chloro-N-methylaniline;2,8-dimethyl-5-phenyl-3,4,6,7,8,8a-hexahydro-1H-isoquinoline;formaldehyde (PubChem CID 143553065) has the molecular formula C25H33ClN2O and a molecular weight of 413.01 g/mol. Its IUPAC name is 4-chloro-N-methylaniline;2,8-dimethyl-5-phenyl-3,4,6,7,8,8a-hexahydro-1H-isoquinoline;formaldehyde.
| Compound Name | 4-chloro-N-methylaniline;2,8-dimethyl-5-phenyl-3,4,6,7,8,8a-hexahydro-1H-isoquinoline;formaldehyde |
|---|---|
| PubChem CID | 143553065 |
| Molecular Formula | C25H33ClN2O |
| Molecular Weight | 413.01 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 4-chloro-N-methylaniline;2,8-dimethyl-5-phenyl-3,4,6,7,8,8a-hexahydro-1H-isoquinoline;formaldehyde |
| SMILES | C=O.CC1CCC(c2ccccc2)=C2CCN(C)CC21.CNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23N.C7H8ClN.CH2O/c1-13-8-9-15(14-6-4-3-5-7-14)16-10-11-18(2)12-17(13)16;1-9-7-4-2-6(8)3-5-7;1-2/h3-7,13,17H,8-12H2,1-2H3;2-5,9H,1H3;1H2 |
| InChIKey | RMWHGDARNGQYSD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.01 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |