C28H31N3O — CID 143553100
acetylene;5-[(5Z)-hepta-2,5-dien-4-yl]-8-methyl-3-(2-pyridin-2-ylethenyl)-3,6,7,9-tetrahydro-1H-pyrrolo[3,2-h]isoquinolin-2-one (PubChem CID 143553100) has the molecular formula C28H31N3O and a molecular weight of 425.58 g/mol. Its IUPAC name is acetylene;5-[(5Z)-hepta-2,5-dien-4-yl]-8-methyl-3-(2-pyridin-2-ylethenyl)-3,6,7,9-tetrahydro-1H-pyrrolo[3,2-h]isoquinolin-2-one.
| Compound Name | acetylene;5-[(5Z)-hepta-2,5-dien-4-yl]-8-methyl-3-(2-pyridin-2-ylethenyl)-3,6,7,9-tetrahydro-1H-pyrrolo[3,2-h]isoquinolin-2-one |
|---|---|
| PubChem CID | 143553100 |
| Molecular Formula | C28H31N3O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | acetylene;5-[(5Z)-hepta-2,5-dien-4-yl]-8-methyl-3-(2-pyridin-2-ylethenyl)-3,6,7,9-tetrahydro-1H-pyrrolo[3,2-h]isoquinolin-2-one |
| SMILES | C#C.CC=CC(/C=C\C)c1cc2c(c3c1CCN(C)C3)NC(=O)C2C=Cc1ccccn1 |
| InChI | InChI=1S/C26H29N3O.C2H2/c1-4-8-18(9-5-2)22-16-23-21(12-11-19-10-6-7-14-27-19)26(30)28-25(23)24-17-29(3)15-13-20(22)24;1-2/h4-12,14,16,18,21H,13,15,17H2,1-3H3,(H,28,30);1-2H/b8-4-,9-5?,12-11?; |
| InChIKey | HZVIYZOXTOSEDR-FNICABSCSA-N |
| XLogP | 5.30 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|