About 2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate
2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate (PubChem CID 143553484) has the molecular formula C15H20Cl2N2O3
and a molecular weight of 347.24 g/mol. Its IUPAC name is 2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate.
Molecular Properties
| Compound Name | 2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate |
| PubChem CID | 143553484 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate |
| SMILES | COC(=O)CNC(=O)N1CCCC1.Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H14N2O3.C7H6Cl2/c1-13-7(11)6-9-8(12)10-4-2-3-5-10;1-5-2-3-6(8)4-7(5)9/h2-6H2,1H3,(H,9,12);2-4H,1H3 |
| InChIKey | XCMLVRQZXSJCNF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate?
The IUPAC name of 2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate (CID 143553484) is 2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate.
What is the SMILES notation for 2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate?
The canonical SMILES for 2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate is COC(=O)CNC(=O)N1CCCC1.Cc1ccc(Cl)cc1Cl.
What is the InChIKey of 2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate?
The InChIKey is XCMLVRQZXSJCNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3.C7H6Cl2/c1-13-7(11)6-9-8(12)10-4-2-3-5-10;1-5-2-3-6(8)4-7(5)9/h2-6H2,1H3,(H,9,12);2-4H,1H3.
What are the key properties of 2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate?
2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate has a molecular weight of 347.24 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-1-methylbenzene;methyl 2-(pyrrolidine-1-carbonylamino)acetate is sourced from PubChem (CID 143553484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).