C23H30F3N5O3S — CID 143553548
[2-[[(1S,5R)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethylamino]-(5-methylpyrazin-2-yl)methanol (PubChem CID 143553548) has the molecular formula C23H30F3N5O3S and a molecular weight of 513.59 g/mol. Its IUPAC name is [2-[[(1S,5R)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethylamino]-(5-methylpyrazin-2-yl)methanol.
| Compound Name | [2-[[(1S,5R)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethylamino]-(5-methylpyrazin-2-yl)methanol |
|---|---|
| PubChem CID | 143553548 |
| Molecular Formula | C23H30F3N5O3S |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | [2-[[(1S,5R)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]ethylamino]-(5-methylpyrazin-2-yl)methanol |
| SMILES | Cc1cnc(C(O)NCCS(=O)(=O)N2[C@@H]3CC[C@H]2CC(C(N)Cc2cc(F)c(F)cc2F)C3)cn1 |
| InChI | InChI=1S/C23H30F3N5O3S/c1-13-11-30-22(12-29-13)23(32)28-4-5-35(33,34)31-16-2-3-17(31)7-15(6-16)21(27)9-14-8-19(25)20(26)10-18(14)24/h8,10-12,15-17,21,23,28,32H,2-7,9,27H2,1H3/t15?,16-,17+,21?,23? |
| InChIKey | LKHHHEKYMNEVSS-LWEMVKECSA-N |
| XLogP | 1.93 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|