C24H35NO4 — CID 143553852
N-[1-(3-ethyl-3-hydroxycyclopentyl)prop-2-enyl]-4-(4-hydroxycyclohexyl)oxy-N-methylbenzamide (PubChem CID 143553852) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is N-[1-(3-ethyl-3-hydroxycyclopentyl)prop-2-enyl]-4-(4-hydroxycyclohexyl)oxy-N-methylbenzamide.
| Compound Name | N-[1-(3-ethyl-3-hydroxycyclopentyl)prop-2-enyl]-4-(4-hydroxycyclohexyl)oxy-N-methylbenzamide |
|---|---|
| PubChem CID | 143553852 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | N-[1-(3-ethyl-3-hydroxycyclopentyl)prop-2-enyl]-4-(4-hydroxycyclohexyl)oxy-N-methylbenzamide |
| SMILES | C=CC(C1CCC(O)(CC)C1)N(C)C(=O)c1ccc(OC2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C24H35NO4/c1-4-22(18-14-15-24(28,5-2)16-18)25(3)23(27)17-6-10-20(11-7-17)29-21-12-8-19(26)9-13-21/h4,6-7,10-11,18-19,21-22,26,28H,1,5,8-9,12-16H2,2-3H3 |
| InChIKey | IWDYJHITRQJQKQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|