About benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene
benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene (PubChem CID 143554181) has the molecular formula C23H24F3NO5
and a molecular weight of 451.44 g/mol. Its IUPAC name is benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene.
Molecular Properties
| Compound Name | benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene |
| PubChem CID | 143554181 |
| Molecular Formula | C23H24F3NO5 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene |
| SMILES | COC(=O)C[C@H]1CN(C(=O)OCc2ccccc2)CCC1=O.FC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C16H19NO5.C7H5F3/c1-21-15(19)9-13-10-17(8-7-14(13)18)16(20)22-11-12-5-3-2-4-6-12;8-7(9,10)6-4-2-1-3-5-6/h2-6,13H,7-11H2,1H3;1-5H/t13-;/m0./s1 |
| InChIKey | OOPFTRCGPRXRFX-ZOWNYOTGSA-N |
| XLogP | 4.48 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene?
The IUPAC name of benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene (CID 143554181) is benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene.
What is the SMILES notation for benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene?
The canonical SMILES for benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene is COC(=O)C[C@H]1CN(C(=O)OCc2ccccc2)CCC1=O.FC(F)(F)c1ccccc1.
What is the InChIKey of benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene?
The InChIKey is OOPFTRCGPRXRFX-ZOWNYOTGSA-N. The full InChI is InChI=1S/C16H19NO5.C7H5F3/c1-21-15(19)9-13-10-17(8-7-14(13)18)16(20)22-11-12-5-3-2-4-6-12;8-7(9,10)6-4-2-1-3-5-6/h2-6,13H,7-11H2,1H3;1-5H/t13-;/m0./s1.
What are the key properties of benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene?
benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene has a molecular weight of 451.44 g/mol, XLogP of 4.48, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (3S)-3-(2-methoxy-2-oxoethyl)-4-oxopiperidine-1-carboxylate;trifluoromethylbenzene is sourced from PubChem (CID 143554181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).