C20H22F3N3O2S — CID 143554406
N-[2-[(E)-N-[cyclohexa-1,5-dien-1-yl(methyl)amino]-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoro-N-prop-2-ynylmethanesulfonamide (PubChem CID 143554406) has the molecular formula C20H22F3N3O2S and a molecular weight of 425.48 g/mol. Its IUPAC name is N-[2-[(E)-N-[cyclohexa-1,5-dien-1-yl(methyl)amino]-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoro-N-prop-2-ynylmethanesulfonamide.
| Compound Name | N-[2-[(E)-N-[cyclohexa-1,5-dien-1-yl(methyl)amino]-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoro-N-prop-2-ynylmethanesulfonamide |
|---|---|
| PubChem CID | 143554406 |
| Molecular Formula | C20H22F3N3O2S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[2-[(E)-N-[cyclohexa-1,5-dien-1-yl(methyl)amino]-C-methylcarbonimidoyl]-4-methylphenyl]-1,1,1-trifluoro-N-prop-2-ynylmethanesulfonamide |
| SMILES | C#CCN(c1ccc(C)cc1/C(C)=N/N(C)C1=CCCC=C1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H22F3N3O2S/c1-5-13-26(29(27,28)20(21,22)23)19-12-11-15(2)14-18(19)16(3)24-25(4)17-9-7-6-8-10-17/h1,7,9-12,14H,6,8,13H2,2-4H3/b24-16+ |
| InChIKey | SCKCIWJLLWIIMF-LFVJCYFKSA-N |
| XLogP | 4.17 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|