C8H7N3 — CID 143554696
1-(7,8-diazabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-yl)ethanimine (PubChem CID 143554696) has the molecular formula C8H7N3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 1-(7,8-diazabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-yl)ethanimine.
| Compound Name | 1-(7,8-diazabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-yl)ethanimine |
|---|---|
| PubChem CID | 143554696 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 1-(7,8-diazabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-yl)ethanimine |
| SMILES | [H]/N=C(\C)c1ccc2c(c1)N=N2 |
| InChI | InChI=1S/C8H7N3/c1-5(9)6-2-3-7-8(4-6)11-10-7/h2-4,9H,1H3/b9-5+ |
| InChIKey | MWIFXGNLEVXLCB-WEVVVXLNSA-N |
| XLogP | 2.80 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|