C19H14F6N4O2 — CID 143554751
2-methanimidoyl-5-[5-[3-(trifluoromethyl)-4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 143554751) has the molecular formula C19H14F6N4O2 and a molecular weight of 444.34 g/mol. Its IUPAC name is 2-methanimidoyl-5-[5-[3-(trifluoromethyl)-4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | 2-methanimidoyl-5-[5-[3-(trifluoromethyl)-4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 143554751 |
| Molecular Formula | C19H14F6N4O2 |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 2-methanimidoyl-5-[5-[3-(trifluoromethyl)-4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | [H]/N=C/c1ccc(-c2noc(-c3ccc(OC(C)C(F)(F)F)c(C(F)(F)F)c3)n2)cc1N |
| InChI | InChI=1S/C19H14F6N4O2/c1-9(18(20,21)22)30-15-5-4-11(6-13(15)19(23,24)25)17-28-16(29-31-17)10-2-3-12(8-26)14(27)7-10/h2-9,26H,27H2,1H3/b26-8+ |
| InChIKey | PXQMWQIOFFZTCP-MWRNPHMMSA-N |
| XLogP | 5.33 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|